![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1-1-06.html | 2006-05-19 13:42 | 13K | |
| 1-1_files/ | 2006-05-15 13:00 | - | |
| 1-2-06.html | 2006-05-19 18:21 | 9.7K | |
| 1-File-Sharing Arguments For and Against_files/ | 2006-05-15 13:02 | - | |
| 1-File Sharing A debate_files/ | 2006-05-15 13:01 | - | |
| 1-History.html | 2006-05-15 16:39 | 6.5K | |
| 1-History_files/ | 2006-05-15 13:03 | - | |
| 1-Structure.html | 2006-05-15 16:39 | 7.0K | |
| 1-Structure_files/ | 2006-05-15 13:05 | - | |
| 1-downloadillegal.html | 2006-05-15 16:38 | 4.9K | |
| 1-downloadillegal_files/ | 2006-05-15 13:00 | - | |
| 1-downloadimprove.html | 2006-05-15 16:39 | 7.1K | |
| 1-downloadimprove_files/ | 2006-05-15 13:00 | - | |
| 1-downloadsummary.html | 2006-05-15 16:38 | 20K | |
| 1-downloadsummary_files/ | 2006-05-15 13:00 | - | |
| 2-1-06.html | 2006-05-19 18:26 | 11K | |
| 2-1-07.html | 2007-05-14 10:45 | 10K | |
| 2-2-06.html | 2006-05-19 18:36 | 6.7K | |
| 2-2-07.html | 2007-05-14 11:13 | 6.6K | |
| 2-Applications.htm | 2006-05-19 18:30 | 6.6K | |
| 2-Applications_files/ | 2006-05-15 13:12 | - | |
| 2-Search Engines.htm | 2006-05-19 16:11 | 6.9K | |
| 2-Search Engines.ppt | 2006-05-19 16:11 | 651K | |
| 2-Search Engines_files/ | 2006-05-15 13:16 | - | |
| 2-Search Engines test.ppt | 2006-05-19 16:19 | 860K | |
| 2-Search Strategy.htm | 2006-05-19 16:20 | 7.4K | |
| 2-Search Strategy_files/ | 2006-05-15 13:18 | - | |
| 2-Search TermsWeb.htm | 2006-05-19 16:20 | 7.0K | |
| 2-Search TermsWeb_files/ | 2006-05-15 13:20 | - | |
| 2-searchengines_files/ | 2006-05-15 13:23 | - | |
| 2-searchstrategy_files/ | 2006-05-15 13:26 | - | |
| 2-searchtermsweb_files/ | 2006-05-15 13:27 | - | |
| 3-1-06.html | 2006-05-28 04:32 | 9.7K | |
| 3-1-07.html | 2007-05-14 11:32 | 9.5K | |
| 3-2-06.html | 2006-05-28 04:44 | 7.7K | |
| 3-2-07.html | 2007-05-14 12:03 | 7.3K | |
| 3-Evaluation.htm | 2006-05-28 04:21 | 6.7K | |
| 3-Evaluation.ppt | 2006-05-28 04:21 | 107K | |
| 3-Evaluation_files/ | 2006-05-15 13:29 | - | |
| 3-KirkEvaluating.htm | 2006-05-28 04:23 | 33K | |
| 3-KirkEvaluating_files/ | 2006-05-15 13:30 | - | |
| 3-Legal.htm | 2006-05-28 04:37 | 6.4K | |
| 3-Legal.ppt | 2006-05-28 04:36 | 85K | |
| 3-Legal_files/ | 2006-05-15 13:30 | - | |
| 4-1-06.html | 2006-06-02 18:40 | 7.8K | |
| 4-1-07.html | 2007-05-14 12:57 | 7.6K | |
| 4-2-06.html | 2006-06-02 18:20 | 6.0K | |
| 4-2-07.html | 2007-05-14 12:57 | 5.8K | |
| 4-Public.htm | 2006-06-02 16:35 | 2.4K | |
| 4-Public05.htm | 2006-06-02 16:35 | 7.1K | |
| 4-Public05A_files/ | 2006-05-15 13:39 | - | |
| 4-Public05_files/ | 2006-05-15 13:33 | - | |
| 4-Public06.htm | 2006-06-02 17:00 | 2.5K | |
| 4-Public06_files/ | 2006-06-02 17:09 | - | |
| 4-Public Records.htm | 2006-06-02 17:35 | 2.6K | |
| 4-PublicRecords.htm | 2006-06-02 18:20 | 2.2K | |
| 4-Public Records_files/ | 2006-06-02 17:43 | - | |
| 4-PublicRecords_files/ | 2006-06-02 18:32 | - | |
| 4-Public_files/ | 2006-05-15 13:47 | - | |
| 4-Specialized.htm | 2006-06-02 16:38 | 2.6K | |
| 4-Specialized05.htm | 2006-06-02 16:38 | 6.7K | |
| 4-Specialized05_files/ | 2006-05-15 13:49 | - | |
| 4-Specialized_files/ | 2006-05-15 13:53 | - | |
| 5-1-06.html | 2006-06-19 06:47 | 8.1K | |
| 5-1-07.html | 2007-06-02 07:12 | 8.3K | |
| 5-2-06.html | 2006-06-19 07:27 | 6.2K | |
| 5-2-07.html | 2007-06-01 22:23 | 6.0K | |
| 5-Databases.htm | 2006-06-19 06:46 | 6.5K | |
| 5-Databases_files/ | 2006-05-15 13:55 | - | |
| 5-Listservs.htm | 2006-06-19 07:11 | 2.5K | |
| 5-Listservs_files/ | 2006-05-15 14:03 | - | |
| 6-1-06.html | 2006-06-26 21:29 | 9.7K | |
| 6-1-07.html | 2007-06-01 22:08 | 8.6K | |
| 6-2-06.html | 2006-06-26 21:29 | 3.8K | |
| 6-2-07.html | 2007-06-01 22:09 | 3.6K | |
| 6-GBH.htm | 2006-06-26 21:30 | 2.4K | |
| 6-GBH05.htm | 2006-06-26 21:30 | 7.3K | |
| 6-GBH05_files/ | 2006-05-15 14:05 | - | |
| 6-GBH_files/ | 2006-05-15 14:16 | - | |
| 10reasonsLirbaries_files/ | 2006-05-15 13:10 | - | |
| Berners-Lee Prize 04_files/ | 2006-05-15 14:16 | - | |
| Blackboard 04/ | 2006-05-15 14:18 | - | |
| Blair & Technology.htm | 2006-05-28 04:27 | 29K | |
| Blair & Technology_files/ | 2006-05-15 14:21 | - | |
| Blair-Story.htm | 2006-05-28 04:26 | 67K | |
| Blair-Story_files/ | 2006-05-15 14:23 | - | |
| Citing_Onnline_files/ | 2006-05-15 14:24 | - | |
| Cover Story In Search Of The Real Google.htm | 2006-05-19 14:33 | 42K | |
| Cover Story In Search Of The Real Google_files/ | 2006-05-19 18:10 | - | |
| Darwin.pdf | 2006-06-26 21:35 | 201K | |
| DonationsOnline_files/ | 2006-05-15 14:24 | - | |
| Facebook 06.htm | 2006-06-19 07:03 | 51K | |
| Facebook NY logo.gif | 2006-06-19 07:03 | 3.2K | |
| FakePlane.jpg | 2006-05-28 04:18 | 28K | |
| Google-Pervasive.htm | 2006-05-19 14:37 | 14K | |
| Google-Pervasive_files/ | 2006-05-19 17:19 | - | |
| Google-Window.htm | 2006-05-19 14:37 | 14K | |
| Google-Window_files/ | 2006-05-19 17:19 | - | |
| Google 04 W Post_files/ | 2006-05-15 14:52 | - | |
| Google Images/ | 2006-05-19 17:48 | - | |
| Googlehalloween03.gif | 2006-05-19 14:38 | 16K | |
| Google icons/ | 2006-05-15 15:06 | - | |
| Googlemania.htm | 2006-05-19 14:39 | 102K | |
| Googlemania_files/ | 2006-05-19 17:28 | - | |
| Google newyear04.gif | 2006-05-19 14:36 | 14K | |
| Google on Mars.gif | 2006-05-19 14:37 | 13K | |
| Interview Meet The Google Guys.htm | 2006-05-19 14:34 | 14K | |
| Interview Meet The Google Guys_files/ | 2006-05-19 18:12 | - | |
| Privacy-Table.htm | 2006-05-28 05:23 | 6.4K | |
| Privacy-Table_files/ | 2006-05-28 04:52 | - | |
| Privacy-Terror.htm | 2006-05-28 05:08 | 22K | |
| Privacy-TerrorTools.htm | 2006-05-28 05:15 | 6.3K | |
| Privacy-TerrorTools_files/ | 2006-05-28 04:48 | - | |
| Privacy-Terror_files/ | 2006-05-28 04:50 | - | |
| Privacy-cover.jpg | 2006-05-28 04:41 | 21K | |
| Time Cover 06.jpg | 2006-05-19 17:37 | 56K | |
| Wired 12_03 The Complete Guide toGooglemania!.htm | 2006-05-19 17:58 | 102K | |
| Wired 12_03 The Complete Guide toGooglemania!_files/ | 2006-05-19 18:07 | - | |
| XFINAL PROJECT/ | 2009-03-11 17:45 | - | |
| attendance.html | 2006-05-15 16:29 | 4.3K | |
| computerhead.JPG | 2006-05-15 16:34 | 5.2K | |
| grading.html | 2006-05-15 16:29 | 14K | |
| home.html | 2006-05-15 16:30 | 3.2K | |
| learning.html | 2006-05-15 16:30 | 3.9K | |
| objectives.html | 2006-05-15 16:30 | 2.0K | |
| registration.html | 2006-05-15 16:31 | 3.7K | |
| schedule.html | 2006-05-15 16:37 | 8.6K | |
| texts.html | 2006-05-15 16:32 | 3.1K | |